C25H31NO2S — CID 143324885
2-[(2-ethylphenyl)methyl]thiophene;(3Z,5Z)-6-(nitromethyl)undeca-3,5-dien-1-yne (PubChem CID 143324885) has the molecular formula C25H31NO2S and a molecular weight of 409.60 g/mol. Its IUPAC name is 2-[(2-ethylphenyl)methyl]thiophene;(3Z,5Z)-6-(nitromethyl)undeca-3,5-dien-1-yne.
| Compound Name | 2-[(2-ethylphenyl)methyl]thiophene;(3Z,5Z)-6-(nitromethyl)undeca-3,5-dien-1-yne |
|---|---|
| PubChem CID | 143324885 |
| Molecular Formula | C25H31NO2S |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 2-[(2-ethylphenyl)methyl]thiophene;(3Z,5Z)-6-(nitromethyl)undeca-3,5-dien-1-yne |
| SMILES | C#C/C=C\C=C(\CCCCC)C[N+](=O)[O-].CCc1ccccc1Cc1cccs1 |
| InChI | InChI=1S/C13H14S.C12H17NO2/c1-2-11-6-3-4-7-12(11)10-13-8-5-9-14-13;1-3-5-7-9-12(11-13(14)15)10-8-6-4-2/h3-9H,2,10H2,1H3;1,5,7,9H,4,6,8,10-11H2,2H3/b;7-5-,12-9- |
| InChIKey | MAZQWMDGTRAMFX-BYZFKGTASA-N |
| XLogP | 6.86 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|