C22H24NO2PS2 — CID 156636047
bis(4-methylphenyl)-[(2R)-1-nitro-4-thiophen-2-ylbutan-2-yl]-sulfanylidene-λ5-phosphane (PubChem CID 156636047) has the molecular formula C22H24NO2PS2 and a molecular weight of 429.55 g/mol. Its IUPAC name is bis(4-methylphenyl)-[(2R)-1-nitro-4-thiophen-2-ylbutan-2-yl]-sulfanylidene-λ5-phosphane.
| Compound Name | bis(4-methylphenyl)-[(2R)-1-nitro-4-thiophen-2-ylbutan-2-yl]-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 156636047 |
| Molecular Formula | C22H24NO2PS2 |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | bis(4-methylphenyl)-[(2R)-1-nitro-4-thiophen-2-ylbutan-2-yl]-sulfanylidene-λ5-phosphane |
| SMILES | Cc1ccc(P(=S)(c2ccc(C)cc2)[C@H](CCc2cccs2)C[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H24NO2PS2/c1-17-5-9-19(10-6-17)26(27,20-11-7-18(2)8-12-20)21(16-23(24)25)13-14-22-4-3-15-28-22/h3-12,15,21H,13-14,16H2,1-2H3/t21-/m1/s1 |
| InChIKey | TWINJHJHTITHSU-OAQYLSRUSA-N |
| XLogP | 5.07 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|