C21H19F3NO2PS2 — CID 156636053
bis(4-methylphenyl)-sulfanylidene-[(2S)-1,1,1-trifluoro-3-nitro-2-thiophen-3-ylpropan-2-yl]-λ5-phosphane (PubChem CID 156636053) has the molecular formula C21H19F3NO2PS2 and a molecular weight of 469.49 g/mol. Its IUPAC name is bis(4-methylphenyl)-sulfanylidene-[(2S)-1,1,1-trifluoro-3-nitro-2-thiophen-3-ylpropan-2-yl]-λ5-phosphane.
| Compound Name | bis(4-methylphenyl)-sulfanylidene-[(2S)-1,1,1-trifluoro-3-nitro-2-thiophen-3-ylpropan-2-yl]-λ5-phosphane |
|---|---|
| PubChem CID | 156636053 |
| Molecular Formula | C21H19F3NO2PS2 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | bis(4-methylphenyl)-sulfanylidene-[(2S)-1,1,1-trifluoro-3-nitro-2-thiophen-3-ylpropan-2-yl]-λ5-phosphane |
| SMILES | Cc1ccc(P(=S)(c2ccc(C)cc2)[C@](C[N+](=O)[O-])(c2ccsc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H19F3NO2PS2/c1-15-3-7-18(8-4-15)28(29,19-9-5-16(2)6-10-19)20(14-25(26)27,21(22,23)24)17-11-12-30-13-17/h3-13H,14H2,1-2H3/t20-/m1/s1 |
| InChIKey | SCDWXMITYNNFCD-HXUWFJFHSA-N |
| XLogP | 5.53 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|