C27H31NO2S — CID 144795049
4-[1-[2,5-dimethyl-4-(2-nitroethyl)phenyl]ethyl]-2-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)thiophene (PubChem CID 144795049) has the molecular formula C27H31NO2S and a molecular weight of 433.62 g/mol. Its IUPAC name is 4-[1-[2,5-dimethyl-4-(2-nitroethyl)phenyl]ethyl]-2-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)thiophene.
| Compound Name | 4-[1-[2,5-dimethyl-4-(2-nitroethyl)phenyl]ethyl]-2-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)thiophene |
|---|---|
| PubChem CID | 144795049 |
| Molecular Formula | C27H31NO2S |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 4-[1-[2,5-dimethyl-4-(2-nitroethyl)phenyl]ethyl]-2-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl)thiophene |
| SMILES | Cc1cc(C(C)c2csc(-c3ccc4c(c3)CCCCC4)c2)c(C)cc1CC[N+](=O)[O-] |
| InChI | InChI=1S/C27H31NO2S/c1-18-14-26(19(2)13-22(18)11-12-28(29)30)20(3)25-16-27(31-17-25)24-10-9-21-7-5-4-6-8-23(21)15-24/h9-10,13-17,20H,4-8,11-12H2,1-3H3 |
| InChIKey | SQTSMRLWHVOMMS-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|