C23H40N4O3S3 — CID 144795193
2,6-diamino-N-[6-[2-[3,4-bis(sulfanylmethyl)phenoxy]ethylamino]-6-oxohexyl]-2-methylsulfanylhexanamide (PubChem CID 144795193) has the molecular formula C23H40N4O3S3 and a molecular weight of 516.80 g/mol. Its IUPAC name is 2,6-diamino-N-[6-[2-[3,4-bis(sulfanylmethyl)phenoxy]ethylamino]-6-oxohexyl]-2-methylsulfanylhexanamide.
| Compound Name | 2,6-diamino-N-[6-[2-[3,4-bis(sulfanylmethyl)phenoxy]ethylamino]-6-oxohexyl]-2-methylsulfanylhexanamide |
|---|---|
| PubChem CID | 144795193 |
| Molecular Formula | C23H40N4O3S3 |
| Molecular Weight | 516.80 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | 2,6-diamino-N-[6-[2-[3,4-bis(sulfanylmethyl)phenoxy]ethylamino]-6-oxohexyl]-2-methylsulfanylhexanamide |
| SMILES | CSC(N)(CCCCN)C(=O)NCCCCCC(=O)NCCOc1ccc(CS)c(CS)c1 |
| InChI | InChI=1S/C23H40N4O3S3/c1-33-23(25,10-4-5-11-24)22(29)27-12-6-2-3-7-21(28)26-13-14-30-20-9-8-18(16-31)19(15-20)17-32/h8-9,15,31-32H,2-7,10-14,16-17,24-25H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | KAXCROPOOXFRAD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.80 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|