C17H27NO2S2 — CID 139514619
N-[2-[3,4-bis(sulfanylmethyl)phenoxy]ethyl]heptanamide (PubChem CID 139514619) has the molecular formula C17H27NO2S2 and a molecular weight of 341.54 g/mol. Its IUPAC name is N-[2-[3,4-bis(sulfanylmethyl)phenoxy]ethyl]heptanamide.
| Compound Name | N-[2-[3,4-bis(sulfanylmethyl)phenoxy]ethyl]heptanamide |
|---|---|
| PubChem CID | 139514619 |
| Molecular Formula | C17H27NO2S2 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | N-[2-[3,4-bis(sulfanylmethyl)phenoxy]ethyl]heptanamide |
| SMILES | CCCCCCC(=O)NCCOc1ccc(CS)c(CS)c1 |
| InChI | InChI=1S/C17H27NO2S2/c1-2-3-4-5-6-17(19)18-9-10-20-16-8-7-14(12-21)15(11-16)13-22/h7-8,11,21-22H,2-6,9-10,12-13H2,1H3,(H,18,19) |
| InChIKey | SQHYAVPETNSIHL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|