C28H31FN4O6 — CID 144795978
(2E,4E)-5-(2-amino-2-oxoethoxy)-N-[2-[6-(7-fluoro-1H-indol-3-yl)-5-methoxy-2-pyridinyl]-2-hydroxypropyl]-6-methoxy-2-methylhepta-2,4,6-trienamide (PubChem CID 144795978) has the molecular formula C28H31FN4O6 and a molecular weight of 538.58 g/mol. Its IUPAC name is (2E,4E)-5-(2-amino-2-oxoethoxy)-N-[2-[6-(7-fluoro-1H-indol-3-yl)-5-methoxy-2-pyridinyl]-2-hydroxypropyl]-6-methoxy-2-methylhepta-2,4,6-trienamide.
| Compound Name | (2E,4E)-5-(2-amino-2-oxoethoxy)-N-[2-[6-(7-fluoro-1H-indol-3-yl)-5-methoxy-2-pyridinyl]-2-hydroxypropyl]-6-methoxy-2-methylhepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 144795978 |
| Molecular Formula | C28H31FN4O6 |
| Molecular Weight | 538.58 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | (2E,4E)-5-(2-amino-2-oxoethoxy)-N-[2-[6-(7-fluoro-1H-indol-3-yl)-5-methoxy-2-pyridinyl]-2-hydroxypropyl]-6-methoxy-2-methylhepta-2,4,6-trienamide |
| SMILES | C=C(OC)/C(=C\C=C(/C)C(=O)NCC(C)(O)c1ccc(OC)c(-c2c[nH]c3c(F)cccc23)n1)OCC(N)=O |
| InChI | InChI=1S/C28H31FN4O6/c1-16(9-10-21(17(2)37-4)39-14-24(30)34)27(35)32-15-28(3,36)23-12-11-22(38-5)26(33-23)19-13-31-25-18(19)7-6-8-20(25)29/h6-13,31,36H,2,14-15H2,1,3-5H3,(H2,30,34)(H,32,35)/b16-9+,21-10+ |
| InChIKey | JUDNGPRRMBNRQK-PGZNPFONSA-N |
| XLogP | 3.19 |
| TPSA | 148.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.58 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|