C19H27BF3NO3 — CID 144796589
(3,3-difluoropyrrolidin-1-yl)-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone;ethane (PubChem CID 144796589) has the molecular formula C19H27BF3NO3 and a molecular weight of 385.24 g/mol. Its IUPAC name is (3,3-difluoropyrrolidin-1-yl)-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone;ethane.
| Compound Name | (3,3-difluoropyrrolidin-1-yl)-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone;ethane |
|---|---|
| PubChem CID | 144796589 |
| Molecular Formula | C19H27BF3NO3 |
| Molecular Weight | 385.24 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | (3,3-difluoropyrrolidin-1-yl)-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone;ethane |
| SMILES | CC.CC1(C)OB(c2ccc(C(=O)N3CCC(F)(F)C3)c(F)c2)OC1(C)C |
| InChI | InChI=1S/C17H21BF3NO3.C2H6/c1-15(2)16(3,4)25-18(24-15)11-5-6-12(13(19)9-11)14(23)22-8-7-17(20,21)10-22;1-2/h5-6,9H,7-8,10H2,1-4H3;1-2H3 |
| InChIKey | QOPHFEXDXJMCNZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.24 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|