C18H32O2 — CID 14479659
[(10E,12Z)-hexadeca-10,12-dienyl] acetate (PubChem CID 14479659) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is [(10E,12Z)-hexadeca-10,12-dienyl] acetate.
| Compound Name | [(10E,12Z)-hexadeca-10,12-dienyl] acetate |
|---|---|
| PubChem CID | 14479659 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | [(10E,12Z)-hexadeca-10,12-dienyl] acetate |
| SMILES | CCC/C=C\C=C\CCCCCCCCCOC(C)=O |
| InChI | InChI=1S/C18H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18(2)19/h5-8H,3-4,9-17H2,1-2H3/b6-5-,8-7+ |
| InChIKey | CMCBHGAXGCXMIP-IGTJQSIKSA-N |
| XLogP | 5.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|