C23H30O — CID 144797728
(2E,5E)-3,5-bis[(Z)-(2-methylidenecyclohexylidene)methyl]hepta-2,5-dien-4-one (PubChem CID 144797728) has the molecular formula C23H30O and a molecular weight of 322.49 g/mol. Its IUPAC name is (2E,5E)-3,5-bis[(Z)-(2-methylidenecyclohexylidene)methyl]hepta-2,5-dien-4-one.
| Compound Name | (2E,5E)-3,5-bis[(Z)-(2-methylidenecyclohexylidene)methyl]hepta-2,5-dien-4-one |
|---|---|
| PubChem CID | 144797728 |
| Molecular Formula | C23H30O |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (2E,5E)-3,5-bis[(Z)-(2-methylidenecyclohexylidene)methyl]hepta-2,5-dien-4-one |
| SMILES | C=C1CCCC/C1=C/C(=C\C)C(=O)C(/C=C1/CCCCC1=C)=C/C |
| InChI | InChI=1S/C23H30O/c1-5-19(15-21-13-9-7-11-17(21)3)23(24)20(6-2)16-22-14-10-8-12-18(22)4/h5-6,15-16H,3-4,7-14H2,1-2H3/b19-5+,20-6+,21-15-,22-16- |
| InChIKey | XFDDDHTXGHNBGF-RLKJZMKCSA-N |
| XLogP | 6.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|