C12H20 — CID 134843353
(1E)-1-(3-methylbutylidene)-2-methylidenecyclohexane (PubChem CID 134843353) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is (1E)-1-(3-methylbutylidene)-2-methylidenecyclohexane.
| Compound Name | (1E)-1-(3-methylbutylidene)-2-methylidenecyclohexane |
|---|---|
| PubChem CID | 134843353 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | (1E)-1-(3-methylbutylidene)-2-methylidenecyclohexane |
| SMILES | C=C1CCCC/C1=C\CC(C)C |
| InChI | InChI=1S/C12H20/c1-10(2)8-9-12-7-5-4-6-11(12)3/h9-10H,3-8H2,1-2H3/b12-9+ |
| InChIKey | XQPYFBCACYSLIX-FMIVXFBMSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |