C25H32N4O4 — CID 144798277
(Z)-but-2-ene;1-[(4-carbamoylphenyl)methyl]pyrrolo[3,2-b]pyridine-3-carboxamide;oxan-3-ol (PubChem CID 144798277) has the molecular formula C25H32N4O4 and a molecular weight of 452.56 g/mol. Its IUPAC name is (Z)-but-2-ene;1-[(4-carbamoylphenyl)methyl]pyrrolo[3,2-b]pyridine-3-carboxamide;oxan-3-ol.
| Compound Name | (Z)-but-2-ene;1-[(4-carbamoylphenyl)methyl]pyrrolo[3,2-b]pyridine-3-carboxamide;oxan-3-ol |
|---|---|
| PubChem CID | 144798277 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | (Z)-but-2-ene;1-[(4-carbamoylphenyl)methyl]pyrrolo[3,2-b]pyridine-3-carboxamide;oxan-3-ol |
| SMILES | C/C=C\C.NC(=O)c1ccc(Cn2cc(C(N)=O)c3ncccc32)cc1.OC1CCCOC1 |
| InChI | InChI=1S/C16H14N4O2.C5H10O2.C4H8/c17-15(21)11-5-3-10(4-6-11)8-20-9-12(16(18)22)14-13(20)2-1-7-19-14;6-5-2-1-3-7-4-5;1-3-4-2/h1-7,9H,8H2,(H2,17,21)(H2,18,22);5-6H,1-4H2;3-4H,1-2H3/b;;4-3- |
| InChIKey | XDJAXDGJTJSGKG-PWIAZYAQSA-N |
| XLogP | 3.02 |
| TPSA | 133.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|