C19H19ClN4O3 — CID 121464527
1-[(6-chloro-3-pyridinyl)methyl]-N-[(3R,4S)-3-hydroxyoxan-4-yl]pyrrolo[3,2-b]pyridine-3-carboxamide (PubChem CID 121464527) has the molecular formula C19H19ClN4O3 and a molecular weight of 386.84 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]-N-[(3R,4S)-3-hydroxyoxan-4-yl]pyrrolo[3,2-b]pyridine-3-carboxamide.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]-N-[(3R,4S)-3-hydroxyoxan-4-yl]pyrrolo[3,2-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 121464527 |
| Molecular Formula | C19H19ClN4O3 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]-N-[(3R,4S)-3-hydroxyoxan-4-yl]pyrrolo[3,2-b]pyridine-3-carboxamide |
| SMILES | O=C(N[C@H]1CCOC[C@@H]1O)c1cn(Cc2ccc(Cl)nc2)c2cccnc12 |
| InChI | InChI=1S/C19H19ClN4O3/c20-17-4-3-12(8-22-17)9-24-10-13(18-15(24)2-1-6-21-18)19(26)23-14-5-7-27-11-16(14)25/h1-4,6,8,10,14,16,25H,5,7,9,11H2,(H,23,26)/t14-,16-/m0/s1 |
| InChIKey | KLSXWIVAVTYMPO-HOCLYGCPSA-N |
| XLogP | 2.01 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|