C20H19ClFN3O3 — CID 138560533
3-[(2-chloro-4-pyridinyl)methyl]-8-fluoro-N-(3-hydroxyoxan-4-yl)indolizine-1-carboxamide (PubChem CID 138560533) has the molecular formula C20H19ClFN3O3 and a molecular weight of 403.84 g/mol. Its IUPAC name is 3-[(2-chloro-4-pyridinyl)methyl]-8-fluoro-N-(3-hydroxyoxan-4-yl)indolizine-1-carboxamide.
| Compound Name | 3-[(2-chloro-4-pyridinyl)methyl]-8-fluoro-N-(3-hydroxyoxan-4-yl)indolizine-1-carboxamide |
|---|---|
| PubChem CID | 138560533 |
| Molecular Formula | C20H19ClFN3O3 |
| Molecular Weight | 403.84 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 3-[(2-chloro-4-pyridinyl)methyl]-8-fluoro-N-(3-hydroxyoxan-4-yl)indolizine-1-carboxamide |
| SMILES | O=C(NC1CCOCC1O)c1cc(Cc2ccnc(Cl)c2)n2cccc(F)c12 |
| InChI | InChI=1S/C20H19ClFN3O3/c21-18-9-12(3-5-23-18)8-13-10-14(19-15(22)2-1-6-25(13)19)20(27)24-16-4-7-28-11-17(16)26/h1-3,5-6,9-10,16-17,26H,4,7-8,11H2,(H,24,27) |
| InChIKey | QFNKZOLZYQMLHN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.84 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|