C20H18ClN2O+ — CID 144798856
[4-[(E)-3-[3-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]prop-2-enoyl]phenyl]chloranium (PubChem CID 144798856) has the molecular formula C20H18ClN2O+ and a molecular weight of 337.83 g/mol. Its IUPAC name is [4-[(E)-3-[3-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]prop-2-enoyl]phenyl]chloranium.
| Compound Name | [4-[(E)-3-[3-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]prop-2-enoyl]phenyl]chloranium |
|---|---|
| PubChem CID | 144798856 |
| Molecular Formula | C20H18ClN2O+ |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | [4-[(E)-3-[3-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]prop-2-enoyl]phenyl]chloranium |
| SMILES | Cc1ccc(-c2cc(/C=C/C(=O)c3ccc([ClH+])cc3)[nH]n2)cc1C |
| InChI | InChI=1S/C20H17ClN2O/c1-13-3-4-16(11-14(13)2)19-12-18(22-23-19)9-10-20(24)15-5-7-17(21)8-6-15/h3-12,21H,1-2H3/p+1 |
| InChIKey | YBLUOWOGSAIDAZ-UHFFFAOYSA-O |
| XLogP | 4.29 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|