C10H22N2O2 — CID 144799447
5-amino-3,3,5-trimethyl-2-(methylamino)hexanoic acid (PubChem CID 144799447) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 5-amino-3,3,5-trimethyl-2-(methylamino)hexanoic acid.
| Compound Name | 5-amino-3,3,5-trimethyl-2-(methylamino)hexanoic acid |
|---|---|
| PubChem CID | 144799447 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 5-amino-3,3,5-trimethyl-2-(methylamino)hexanoic acid |
| SMILES | CNC(C(=O)O)C(C)(C)CC(C)(C)N |
| InChI | InChI=1S/C10H22N2O2/c1-9(2,6-10(3,4)11)7(12-5)8(13)14/h7,12H,6,11H2,1-5H3,(H,13,14) |
| InChIKey | QLEMIMOLYDCADA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |