C14H30N2O — CID 174038150
2-amino-2,4,4,6,6-pentamethyl-7-(methylamino)octan-3-one (PubChem CID 174038150) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is 2-amino-2,4,4,6,6-pentamethyl-7-(methylamino)octan-3-one.
| Compound Name | 2-amino-2,4,4,6,6-pentamethyl-7-(methylamino)octan-3-one |
|---|---|
| PubChem CID | 174038150 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | 2-amino-2,4,4,6,6-pentamethyl-7-(methylamino)octan-3-one |
| SMILES | CNC(C)C(C)(C)CC(C)(C)C(=O)C(C)(C)N |
| InChI | InChI=1S/C14H30N2O/c1-10(16-8)12(2,3)9-13(4,5)11(17)14(6,7)15/h10,16H,9,15H2,1-8H3 |
| InChIKey | ISSJIYPNPFLUFV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |