C15H31N3O3 — CID 163858247
8-amino-2,2,5,5,7,7-hexamethyl-4-(2-methylhydrazinyl)-8-oxooctanoic acid (PubChem CID 163858247) has the molecular formula C15H31N3O3 and a molecular weight of 301.43 g/mol. Its IUPAC name is 8-amino-2,2,5,5,7,7-hexamethyl-4-(2-methylhydrazinyl)-8-oxooctanoic acid.
| Compound Name | 8-amino-2,2,5,5,7,7-hexamethyl-4-(2-methylhydrazinyl)-8-oxooctanoic acid |
|---|---|
| PubChem CID | 163858247 |
| Molecular Formula | C15H31N3O3 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | 8-amino-2,2,5,5,7,7-hexamethyl-4-(2-methylhydrazinyl)-8-oxooctanoic acid |
| SMILES | CNNC(CC(C)(C)C(=O)O)C(C)(C)CC(C)(C)C(N)=O |
| InChI | InChI=1S/C15H31N3O3/c1-13(2,12(20)21)8-10(18-17-7)14(3,4)9-15(5,6)11(16)19/h10,17-18H,8-9H2,1-7H3,(H2,16,19)(H,20,21) |
| InChIKey | PAFVNWLBXPNRGK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|