C13H25NO3S — CID 174291605
2,2,4,4-tetramethyl-6-oxo-5-(propan-2-ylamino)-6-sulfanylhexanoic acid (PubChem CID 174291605) has the molecular formula C13H25NO3S and a molecular weight of 275.41 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-6-oxo-5-(propan-2-ylamino)-6-sulfanylhexanoic acid.
| Compound Name | 2,2,4,4-tetramethyl-6-oxo-5-(propan-2-ylamino)-6-sulfanylhexanoic acid |
|---|---|
| PubChem CID | 174291605 |
| Molecular Formula | C13H25NO3S |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 2,2,4,4-tetramethyl-6-oxo-5-(propan-2-ylamino)-6-sulfanylhexanoic acid |
| SMILES | CC(C)NC(C(=O)S)C(C)(C)CC(C)(C)C(=O)O |
| InChI | InChI=1S/C13H25NO3S/c1-8(2)14-9(10(15)18)12(3,4)7-13(5,6)11(16)17/h8-9,14H,7H2,1-6H3,(H,15,18)(H,16,17) |
| InChIKey | DZNSYMWXFMOLAE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|