C16H30O6 — CID 174153145
(5R)-5-[(2R,3S,5R)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-2,2,4,4-tetramethylhexanoic acid (PubChem CID 174153145) has the molecular formula C16H30O6 and a molecular weight of 318.41 g/mol. Its IUPAC name is (5R)-5-[(2R,3S,5R)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-2,2,4,4-tetramethylhexanoic acid.
| Compound Name | (5R)-5-[(2R,3S,5R)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-2,2,4,4-tetramethylhexanoic acid |
|---|---|
| PubChem CID | 174153145 |
| Molecular Formula | C16H30O6 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (5R)-5-[(2R,3S,5R)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-2,2,4,4-tetramethylhexanoic acid |
| SMILES | CC1O[C@@H](O[C@H](C)C(C)(C)CC(C)(C)C(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C16H30O6/c1-9-11(17)7-12(18)13(21-9)22-10(2)15(3,4)8-16(5,6)14(19)20/h9-13,17-18H,7-8H2,1-6H3,(H,19,20)/t9?,10-,11-,12+,13+/m1/s1 |
| InChIKey | VJSHQWQTYKCLSW-AVCYUNSRSA-N |
| XLogP | 1.78 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |