C6H13NOS2 — CID 88817715
(2S)-2-(propan-2-ylamino)-3-sulfanylpropanethioic S-acid (PubChem CID 88817715) has the molecular formula C6H13NOS2 and a molecular weight of 179.31 g/mol. Its IUPAC name is (2S)-2-(propan-2-ylamino)-3-sulfanylpropanethioic S-acid.
| Compound Name | (2S)-2-(propan-2-ylamino)-3-sulfanylpropanethioic S-acid |
|---|---|
| PubChem CID | 88817715 |
| Molecular Formula | C6H13NOS2 |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | (2S)-2-(propan-2-ylamino)-3-sulfanylpropanethioic S-acid |
| SMILES | CC(C)N[C@@H](CS)C(=O)S |
| InChI | InChI=1S/C6H13NOS2/c1-4(2)7-5(3-9)6(8)10/h4-5,7,9H,3H2,1-2H3,(H,8,10)/t5-/m0/s1 |
| InChIKey | BIYYHVRIEMKFER-YFKPBYRVSA-N |
| XLogP | 0.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|