C5H12NOPS2 — CID 155114622
(2S)-2-(methylphosphanylmethylamino)-3-sulfanylpropanethioic S-acid (PubChem CID 155114622) has the molecular formula C5H12NOPS2 and a molecular weight of 197.26 g/mol. Its IUPAC name is (2S)-2-(methylphosphanylmethylamino)-3-sulfanylpropanethioic S-acid.
| Compound Name | (2S)-2-(methylphosphanylmethylamino)-3-sulfanylpropanethioic S-acid |
|---|---|
| PubChem CID | 155114622 |
| Molecular Formula | C5H12NOPS2 |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | (2S)-2-(methylphosphanylmethylamino)-3-sulfanylpropanethioic S-acid |
| SMILES | CPCN[C@@H](CS)C(=O)S |
| InChI | InChI=1S/C5H12NOPS2/c1-8-3-6-4(2-9)5(7)10/h4,6,8-9H,2-3H2,1H3,(H,7,10)/t4-/m0/s1 |
| InChIKey | CGWPMAWNGAZLDP-BYPYZUCNSA-N |
| XLogP | 0.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|