C18H37N3O3S2 — CID 160866076
4-methyl-1-nitrososulfanyl-2-(propan-2-ylamino)pentan-3-one;4-methyl-2-(propan-2-ylamino)-1-sulfanylpentan-3-one (PubChem CID 160866076) has the molecular formula C18H37N3O3S2 and a molecular weight of 407.65 g/mol. Its IUPAC name is 4-methyl-1-nitrososulfanyl-2-(propan-2-ylamino)pentan-3-one;4-methyl-2-(propan-2-ylamino)-1-sulfanylpentan-3-one.
| Compound Name | 4-methyl-1-nitrososulfanyl-2-(propan-2-ylamino)pentan-3-one;4-methyl-2-(propan-2-ylamino)-1-sulfanylpentan-3-one |
|---|---|
| PubChem CID | 160866076 |
| Molecular Formula | C18H37N3O3S2 |
| Molecular Weight | 407.65 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 4-methyl-1-nitrososulfanyl-2-(propan-2-ylamino)pentan-3-one;4-methyl-2-(propan-2-ylamino)-1-sulfanylpentan-3-one |
| SMILES | CC(C)NC(CS)C(=O)C(C)C.CC(C)NC(CSN=O)C(=O)C(C)C |
| InChI | InChI=1S/C9H18N2O2S.C9H19NOS/c1-6(2)9(12)8(5-14-11-13)10-7(3)4;1-6(2)9(11)8(5-12)10-7(3)4/h6-8,10H,5H2,1-4H3;6-8,10,12H,5H2,1-4H3 |
| InChIKey | SLDCYHGDWOVTQV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.65 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|