C27H34IO2P+2 — CID 144800257
[2-(2-iodonio-3,4-dimethoxyphenyl)-4-phenyl-3,5-dipropylphenyl]-methylphosphanium (PubChem CID 144800257) has the molecular formula C27H34IO2P+2 and a molecular weight of 548.45 g/mol. Its IUPAC name is [2-(2-iodonio-3,4-dimethoxyphenyl)-4-phenyl-3,5-dipropylphenyl]-methylphosphanium.
| Compound Name | [2-(2-iodonio-3,4-dimethoxyphenyl)-4-phenyl-3,5-dipropylphenyl]-methylphosphanium |
|---|---|
| PubChem CID | 144800257 |
| Molecular Formula | C27H34IO2P+2 |
| Molecular Weight | 548.45 g/mol |
| Exact Mass | 548.13 |
| IUPAC Name | [2-(2-iodonio-3,4-dimethoxyphenyl)-4-phenyl-3,5-dipropylphenyl]-methylphosphanium |
| SMILES | CCCc1cc([PH2+]C)c(-c2ccc(OC)c(OC)c2[IH+])c(CCC)c1-c1ccccc1 |
| InChI | InChI=1S/C27H33IO2P/c1-6-11-19-17-23(31-5)25(21-15-16-22(29-3)27(30-4)26(21)28)20(12-7-2)24(19)18-13-9-8-10-14-18/h8-10,13-17,28,31H,6-7,11-12H2,1-5H3/q+1/p+1 |
| InChIKey | JWFVARKFQKKQQP-UHFFFAOYSA-O |
| XLogP | 3.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|