C27H32O4 — CID 173310858
2,4-dimethoxy-1,3-bis(4-methoxy-3-methylphenyl)-5-propylbenzene (PubChem CID 173310858) has the molecular formula C27H32O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is 2,4-dimethoxy-1,3-bis(4-methoxy-3-methylphenyl)-5-propylbenzene.
| Compound Name | 2,4-dimethoxy-1,3-bis(4-methoxy-3-methylphenyl)-5-propylbenzene |
|---|---|
| PubChem CID | 173310858 |
| Molecular Formula | C27H32O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 2,4-dimethoxy-1,3-bis(4-methoxy-3-methylphenyl)-5-propylbenzene |
| SMILES | CCCc1cc(-c2ccc(OC)c(C)c2)c(OC)c(-c2ccc(OC)c(C)c2)c1OC |
| InChI | InChI=1S/C27H32O4/c1-8-9-21-16-22(19-10-12-23(28-4)17(2)14-19)27(31-7)25(26(21)30-6)20-11-13-24(29-5)18(3)15-20/h10-16H,8-9H2,1-7H3 |
| InChIKey | ZOIIKFHAWFENGS-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |