C25H26O5 — CID 57197865
2-[6,7-bis(4-methoxy-3-methylphenyl)-1,3-benzodioxol-4-yl]ethanol (PubChem CID 57197865) has the molecular formula C25H26O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is 2-[6,7-bis(4-methoxy-3-methylphenyl)-1,3-benzodioxol-4-yl]ethanol.
| Compound Name | 2-[6,7-bis(4-methoxy-3-methylphenyl)-1,3-benzodioxol-4-yl]ethanol |
|---|---|
| PubChem CID | 57197865 |
| Molecular Formula | C25H26O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 2-[6,7-bis(4-methoxy-3-methylphenyl)-1,3-benzodioxol-4-yl]ethanol |
| SMILES | COc1ccc(-c2cc(CCO)c3c(c2-c2ccc(OC)c(C)c2)OCO3)cc1C |
| InChI | InChI=1S/C25H26O5/c1-15-11-17(5-7-21(15)27-3)20-13-19(9-10-26)24-25(30-14-29-24)23(20)18-6-8-22(28-4)16(2)12-18/h5-8,11-13,26H,9-10,14H2,1-4H3 |
| InChIKey | UKIDJMGZVIPTTJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |