C11H14O4 — CID 142077480
2-(6-methoxy-7-methyl-1,3-benzodioxol-4-yl)ethanol (PubChem CID 142077480) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-(6-methoxy-7-methyl-1,3-benzodioxol-4-yl)ethanol.
| Compound Name | 2-(6-methoxy-7-methyl-1,3-benzodioxol-4-yl)ethanol |
|---|---|
| PubChem CID | 142077480 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-(6-methoxy-7-methyl-1,3-benzodioxol-4-yl)ethanol |
| SMILES | COc1cc(CCO)c2c(c1C)OCO2 |
| InChI | InChI=1S/C11H14O4/c1-7-9(13-2)5-8(3-4-12)11-10(7)14-6-15-11/h5,12H,3-4,6H2,1-2H3 |
| InChIKey | PXJWLRHKSZBYKQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |