C11H22F3N — CID 144800520
ethane;4,4,4-trifluoro-N-methyl-N-(2-methylprop-2-enyl)butan-1-amine (PubChem CID 144800520) has the molecular formula C11H22F3N and a molecular weight of 225.30 g/mol. Its IUPAC name is ethane;4,4,4-trifluoro-N-methyl-N-(2-methylprop-2-enyl)butan-1-amine.
| Compound Name | ethane;4,4,4-trifluoro-N-methyl-N-(2-methylprop-2-enyl)butan-1-amine |
|---|---|
| PubChem CID | 144800520 |
| Molecular Formula | C11H22F3N |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | ethane;4,4,4-trifluoro-N-methyl-N-(2-methylprop-2-enyl)butan-1-amine |
| SMILES | C=C(C)CN(C)CCCC(F)(F)F.CC |
| InChI | InChI=1S/C9H16F3N.C2H6/c1-8(2)7-13(3)6-4-5-9(10,11)12;1-2/h1,4-7H2,2-3H3;1-2H3 |
| InChIKey | LHGCCFVDCDLODM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|