C13H21F2N — CID 166795971
(2E,4Z)-N-(2,2-difluorobutyl)-N,2-dimethylhepta-2,4,6-trien-1-amine (PubChem CID 166795971) has the molecular formula C13H21F2N and a molecular weight of 229.31 g/mol. Its IUPAC name is (2E,4Z)-N-(2,2-difluorobutyl)-N,2-dimethylhepta-2,4,6-trien-1-amine.
| Compound Name | (2E,4Z)-N-(2,2-difluorobutyl)-N,2-dimethylhepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 166795971 |
| Molecular Formula | C13H21F2N |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | (2E,4Z)-N-(2,2-difluorobutyl)-N,2-dimethylhepta-2,4,6-trien-1-amine |
| SMILES | C=C/C=C\C=C(/C)CN(C)CC(F)(F)CC |
| InChI | InChI=1S/C13H21F2N/c1-5-7-8-9-12(3)10-16(4)11-13(14,15)6-2/h5,7-9H,1,6,10-11H2,2-4H3/b8-7-,12-9+ |
| InChIKey | JRUZSXCDUBFYLV-HVTAIUIQSA-N |
| XLogP | 3.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|