C18H25N5O3 — CID 144800695
7-amino-10-ethyl-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-11-carbaldehyde;tert-butyl acetate (PubChem CID 144800695) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 7-amino-10-ethyl-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-11-carbaldehyde;tert-butyl acetate.
| Compound Name | 7-amino-10-ethyl-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-11-carbaldehyde;tert-butyl acetate |
|---|---|
| PubChem CID | 144800695 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 7-amino-10-ethyl-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-11-carbaldehyde;tert-butyl acetate |
| SMILES | CC(=O)OC(C)(C)C.CCn1c(C=O)cc2c3c(ncn3C)c(N)nc21 |
| InChI | InChI=1S/C12H13N5O.C6H12O2/c1-3-17-7(5-18)4-8-10-9(14-6-16(10)2)11(13)15-12(8)17;1-5(7)8-6(2,3)4/h4-6H,3H2,1-2H3,(H2,13,15);1-4H3 |
| InChIKey | CBZCOHVLEQJFRT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|