C29H34ClN7O2 — CID 144801721
2-[3-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2-pyridinyl]-1-[4-(3-methylpiperazine-1-carbonyl)phenyl]guanidine (PubChem CID 144801721) has the molecular formula C29H34ClN7O2 and a molecular weight of 548.09 g/mol. Its IUPAC name is 2-[3-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2-pyridinyl]-1-[4-(3-methylpiperazine-1-carbonyl)phenyl]guanidine.
| Compound Name | 2-[3-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2-pyridinyl]-1-[4-(3-methylpiperazine-1-carbonyl)phenyl]guanidine |
|---|---|
| PubChem CID | 144801721 |
| Molecular Formula | C29H34ClN7O2 |
| Molecular Weight | 548.09 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | 2-[3-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2-pyridinyl]-1-[4-(3-methylpiperazine-1-carbonyl)phenyl]guanidine |
| SMILES | CC1CN(C(=O)c2ccc(N/C(N)=N/c3ncccc3N3CCC(O)(c4ccc(Cl)cc4)CC3)cc2)CCN1 |
| InChI | InChI=1S/C29H34ClN7O2/c1-20-19-37(18-15-32-20)27(38)21-4-10-24(11-5-21)34-28(31)35-26-25(3-2-14-33-26)36-16-12-29(39,13-17-36)22-6-8-23(30)9-7-22/h2-11,14,20,32,39H,12-13,15-19H2,1H3,(H3,31,33,34,35) |
| InChIKey | XIWXWMCQLGFBQQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.09 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|