C37H25N3OS — CID 144803444
(4Z)-4-[5-[3-(10-oxa-15-thia-23-azahexacyclo[11.10.0.03,11.04,9.014,22.016,21]tricosa-1(13),2,4,6,8,11,14(22),16,18,20-decaen-23-yl)phenyl]-1H-pyridin-2-ylidene]hexa-1,5-dien-3-imine (PubChem CID 144803444) has the molecular formula C37H25N3OS and a molecular weight of 559.69 g/mol. Its IUPAC name is (4Z)-4-[5-[3-(10-oxa-15-thia-23-azahexacyclo[11.10.0.03,11.04,9.014,22.016,21]tricosa-1(13),2,4,6,8,11,14(22),16,18,20-decaen-23-yl)phenyl]-1H-pyridin-2-ylidene]hexa-1,5-dien-3-imine.
| Compound Name | (4Z)-4-[5-[3-(10-oxa-15-thia-23-azahexacyclo[11.10.0.03,11.04,9.014,22.016,21]tricosa-1(13),2,4,6,8,11,14(22),16,18,20-decaen-23-yl)phenyl]-1H-pyridin-2-ylidene]hexa-1,5-dien-3-imine |
|---|---|
| PubChem CID | 144803444 |
| Molecular Formula | C37H25N3OS |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | (4Z)-4-[5-[3-(10-oxa-15-thia-23-azahexacyclo[11.10.0.03,11.04,9.014,22.016,21]tricosa-1(13),2,4,6,8,11,14(22),16,18,20-decaen-23-yl)phenyl]-1H-pyridin-2-ylidene]hexa-1,5-dien-3-imine |
| SMILES | [H]/N=C(\C=C)C(C=C)=C1C=CC(c2cccc(-n3c4cc5c(cc4c4sc6ccccc6c43)oc3ccccc35)c2)=CN1 |
| InChI | InChI=1S/C37H25N3OS/c1-3-25(30(38)4-2)31-17-16-23(21-39-31)22-10-9-11-24(18-22)40-32-19-28-26-12-5-7-14-33(26)41-34(28)20-29(32)37-36(40)27-13-6-8-15-35(27)42-37/h3-21,38-39H,1-2H2/b31-25-,38-30+ |
| InChIKey | XTCGFWYSABRTSJ-WXKZWSSPSA-N |
| XLogP | 10.04 |
| TPSA | 53.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|