C37H23N3S2 — CID 144803825
(6Z)-6-[5-[3-(10,15-dithia-23-azahexacyclo[11.10.0.03,11.04,9.014,22.016,21]tricosa-1(13),2,4,6,8,11,14(22),16,18,20-decaen-23-yl)phenyl]-1H-pyridin-2-ylidene]cyclohexa-2,4-dien-1-imine (PubChem CID 144803825) has the molecular formula C37H23N3S2 and a molecular weight of 573.75 g/mol. Its IUPAC name is (6Z)-6-[5-[3-(10,15-dithia-23-azahexacyclo[11.10.0.03,11.04,9.014,22.016,21]tricosa-1(13),2,4,6,8,11,14(22),16,18,20-decaen-23-yl)phenyl]-1H-pyridin-2-ylidene]cyclohexa-2,4-dien-1-imine.
| Compound Name | (6Z)-6-[5-[3-(10,15-dithia-23-azahexacyclo[11.10.0.03,11.04,9.014,22.016,21]tricosa-1(13),2,4,6,8,11,14(22),16,18,20-decaen-23-yl)phenyl]-1H-pyridin-2-ylidene]cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 144803825 |
| Molecular Formula | C37H23N3S2 |
| Molecular Weight | 573.75 g/mol |
| Exact Mass | 573.13 |
| IUPAC Name | (6Z)-6-[5-[3-(10,15-dithia-23-azahexacyclo[11.10.0.03,11.04,9.014,22.016,21]tricosa-1(13),2,4,6,8,11,14(22),16,18,20-decaen-23-yl)phenyl]-1H-pyridin-2-ylidene]cyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=CC=C\C1=C1/C=CC(c2cccc(-n3c4cc5c(cc4c4sc6ccccc6c43)sc3ccccc35)c2)=CN1 |
| InChI | InChI=1S/C37H23N3S2/c38-30-13-4-1-11-26(30)31-17-16-23(21-39-31)22-8-7-9-24(18-22)40-32-19-28-25-10-2-5-14-33(25)41-35(28)20-29(32)37-36(40)27-12-3-6-15-34(27)42-37/h1-21,38-39H/b31-26-,38-30+ |
| InChIKey | UTNUHGSHCJBQOP-GNKLUMHFSA-N |
| XLogP | 10.27 |
| TPSA | 40.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.75 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|