C35H32BN3O2 — CID 144803503
8-[6-(3,4-dihydroquinolin-8-yl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-pyridinyl]quinoline (PubChem CID 144803503) has the molecular formula C35H32BN3O2 and a molecular weight of 537.47 g/mol. Its IUPAC name is 8-[6-(3,4-dihydroquinolin-8-yl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-pyridinyl]quinoline.
| Compound Name | 8-[6-(3,4-dihydroquinolin-8-yl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-pyridinyl]quinoline |
|---|---|
| PubChem CID | 144803503 |
| Molecular Formula | C35H32BN3O2 |
| Molecular Weight | 537.47 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | 8-[6-(3,4-dihydroquinolin-8-yl)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-pyridinyl]quinoline |
| SMILES | CC1(C)OB(c2ccc(-c3cc(-c4cccc5c4N=CCC5)nc(-c4cccc5cccnc45)c3)cc2)OC1(C)C |
| InChI | InChI=1S/C35H32BN3O2/c1-34(2)35(3,4)41-36(40-34)27-17-15-23(16-18-27)26-21-30(28-13-5-9-24-11-7-19-37-32(24)28)39-31(22-26)29-14-6-10-25-12-8-20-38-33(25)29/h5-7,9-11,13-22H,8,12H2,1-4H3 |
| InChIKey | OGPDHFDRAIYQJE-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 56.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.47 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|