About piperidine;3-propan-2-ylbenzaldehyde
piperidine;3-propan-2-ylbenzaldehyde (PubChem CID 144804603) has the molecular formula C15H23NO
and a molecular weight of 233.36 g/mol. Its IUPAC name is piperidine;3-propan-2-ylbenzaldehyde.
Molecular Properties
| Compound Name | piperidine;3-propan-2-ylbenzaldehyde |
| PubChem CID | 144804603 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | piperidine;3-propan-2-ylbenzaldehyde |
| SMILES | C1CCNCC1.CC(C)c1cccc(C=O)c1 |
| InChI | InChI=1S/C10H12O.C5H11N/c1-8(2)10-5-3-4-9(6-10)7-11;1-2-4-6-5-3-1/h3-8H,1-2H3;6H,1-5H2 |
| InChIKey | RFRXUBLCDBRJHC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze piperidine;3-propan-2-ylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine;3-propan-2-ylbenzaldehyde?
The IUPAC name of piperidine;3-propan-2-ylbenzaldehyde (CID 144804603) is piperidine;3-propan-2-ylbenzaldehyde.
What is the SMILES notation for piperidine;3-propan-2-ylbenzaldehyde?
The canonical SMILES for piperidine;3-propan-2-ylbenzaldehyde is C1CCNCC1.CC(C)c1cccc(C=O)c1.
What is the InChIKey of piperidine;3-propan-2-ylbenzaldehyde?
The InChIKey is RFRXUBLCDBRJHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O.C5H11N/c1-8(2)10-5-3-4-9(6-10)7-11;1-2-4-6-5-3-1/h3-8H,1-2H3;6H,1-5H2.
What are the key properties of piperidine;3-propan-2-ylbenzaldehyde?
piperidine;3-propan-2-ylbenzaldehyde has a molecular weight of 233.36 g/mol, XLogP of 3.38, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine;3-propan-2-ylbenzaldehyde is sourced from PubChem (CID 144804603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).