C24H47NO — CID 144804938
N-[2-(3,5-dimethylcyclopent-2-en-1-yl)oxyethyl]-3,7,11-trimethyldodecan-1-amine (PubChem CID 144804938) has the molecular formula C24H47NO and a molecular weight of 365.65 g/mol. Its IUPAC name is N-[2-(3,5-dimethylcyclopent-2-en-1-yl)oxyethyl]-3,7,11-trimethyldodecan-1-amine.
| Compound Name | N-[2-(3,5-dimethylcyclopent-2-en-1-yl)oxyethyl]-3,7,11-trimethyldodecan-1-amine |
|---|---|
| PubChem CID | 144804938 |
| Molecular Formula | C24H47NO |
| Molecular Weight | 365.65 g/mol |
| Exact Mass | 365.37 |
| IUPAC Name | N-[2-(3,5-dimethylcyclopent-2-en-1-yl)oxyethyl]-3,7,11-trimethyldodecan-1-amine |
| SMILES | CC1=CC(OCCNCCC(C)CCCC(C)CCCC(C)C)C(C)C1 |
| InChI | InChI=1S/C24H47NO/c1-19(2)9-7-10-20(3)11-8-12-21(4)13-14-25-15-16-26-24-18-22(5)17-23(24)6/h18-21,23-25H,7-17H2,1-6H3 |
| InChIKey | STLWZAYPNWFLJD-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.65 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|