C12H21NO — CID 170356772
9-propan-2-yl-2,5,6,6a,7,8,9,9a-octahydrooxocino[2,3-c]pyrrole (PubChem CID 170356772) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 9-propan-2-yl-2,5,6,6a,7,8,9,9a-octahydrooxocino[2,3-c]pyrrole.
| Compound Name | 9-propan-2-yl-2,5,6,6a,7,8,9,9a-octahydrooxocino[2,3-c]pyrrole |
|---|---|
| PubChem CID | 170356772 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 9-propan-2-yl-2,5,6,6a,7,8,9,9a-octahydrooxocino[2,3-c]pyrrole |
| SMILES | CC(C)C1NCC2CCC=CCOC21 |
| InChI | InChI=1S/C12H21NO/c1-9(2)11-12-10(8-13-11)6-4-3-5-7-14-12/h3,5,9-13H,4,6-8H2,1-2H3 |
| InChIKey | PVWJUYWMDZYNNG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|