C12H23NO2 — CID 178169071
2,5,6,6a,7,8,9,9a-octahydrooxocino[2,3-c]pyrrol-9-ylmethanol;ethane (PubChem CID 178169071) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 2,5,6,6a,7,8,9,9a-octahydrooxocino[2,3-c]pyrrol-9-ylmethanol;ethane.
| Compound Name | 2,5,6,6a,7,8,9,9a-octahydrooxocino[2,3-c]pyrrol-9-ylmethanol;ethane |
|---|---|
| PubChem CID | 178169071 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 2,5,6,6a,7,8,9,9a-octahydrooxocino[2,3-c]pyrrol-9-ylmethanol;ethane |
| SMILES | CC.OCC1NCC2CCC=CCOC21 |
| InChI | InChI=1S/C10H17NO2.C2H6/c12-7-9-10-8(6-11-9)4-2-1-3-5-13-10;1-2/h1,3,8-12H,2,4-7H2;1-2H3 |
| InChIKey | QGNSYJPZSNDUDS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|