C11H20NO2Re- — CID 178169061
2,5,5a,6,8,8a-hexahydrooxepino[2,3-c]pyrrol-7-id-8-ylmethanol;ethane;rhenium (PubChem CID 178169061) has the molecular formula C11H20NO2Re- and a molecular weight of 384.49 g/mol. Its IUPAC name is 2,5,5a,6,8,8a-hexahydrooxepino[2,3-c]pyrrol-7-id-8-ylmethanol;ethane;rhenium.
| Compound Name | 2,5,5a,6,8,8a-hexahydrooxepino[2,3-c]pyrrol-7-id-8-ylmethanol;ethane;rhenium |
|---|---|
| PubChem CID | 178169061 |
| Molecular Formula | C11H20NO2Re- |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 2,5,5a,6,8,8a-hexahydrooxepino[2,3-c]pyrrol-7-id-8-ylmethanol;ethane;rhenium |
| SMILES | CC.OCC1[N-]CC2CC=CCOC21.[Re] |
| InChI | InChI=1S/C9H14NO2.C2H6.Re/c11-6-8-9-7(5-10-8)3-1-2-4-12-9;1-2;/h1-2,7-9,11H,3-6H2;1-2H3;/q-1;; |
| InChIKey | ZRHYSSUINHJHHF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 43.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|