C12H19NOS — CID 144805204
ethene;2-methoxy-N,N-dimethyl-4-methylsulfanylaniline (PubChem CID 144805204) has the molecular formula C12H19NOS and a molecular weight of 225.36 g/mol. Its IUPAC name is ethene;2-methoxy-N,N-dimethyl-4-methylsulfanylaniline.
| Compound Name | ethene;2-methoxy-N,N-dimethyl-4-methylsulfanylaniline |
|---|---|
| PubChem CID | 144805204 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | ethene;2-methoxy-N,N-dimethyl-4-methylsulfanylaniline |
| SMILES | C=C.COc1cc(SC)ccc1N(C)C |
| InChI | InChI=1S/C10H15NOS.C2H4/c1-11(2)9-6-5-8(13-4)7-10(9)12-3;1-2/h5-7H,1-4H3;1-2H2 |
| InChIKey | SUCFOGZYLLDWIC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|