C25H28 — CID 144806043
1-tert-butyl-2,5-diphenyl-4-propan-2-ylbenzene (PubChem CID 144806043) has the molecular formula C25H28 and a molecular weight of 328.50 g/mol. Its IUPAC name is 1-tert-butyl-2,5-diphenyl-4-propan-2-ylbenzene.
| Compound Name | 1-tert-butyl-2,5-diphenyl-4-propan-2-ylbenzene |
|---|---|
| PubChem CID | 144806043 |
| Molecular Formula | C25H28 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 1-tert-butyl-2,5-diphenyl-4-propan-2-ylbenzene |
| SMILES | CC(C)c1cc(-c2ccccc2)c(C(C)(C)C)cc1-c1ccccc1 |
| InChI | InChI=1S/C25H28/c1-18(2)21-16-23(20-14-10-7-11-15-20)24(25(3,4)5)17-22(21)19-12-8-6-9-13-19/h6-18H,1-5H3 |
| InChIKey | KNNCFHZKQCNDEI-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |