C33H34 — CID 157418767
3,5-ditert-butyl-2,7-diphenyl-9H-fluorene (PubChem CID 157418767) has the molecular formula C33H34 and a molecular weight of 430.64 g/mol. Its IUPAC name is 3,5-ditert-butyl-2,7-diphenyl-9H-fluorene.
| Compound Name | 3,5-ditert-butyl-2,7-diphenyl-9H-fluorene |
|---|---|
| PubChem CID | 157418767 |
| Molecular Formula | C33H34 |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 3,5-ditert-butyl-2,7-diphenyl-9H-fluorene |
| SMILES | CC(C)(C)c1cc2c(cc1-c1ccccc1)Cc1cc(-c3ccccc3)cc(C(C)(C)C)c1-2 |
| InChI | InChI=1S/C33H34/c1-32(2,3)29-21-28-25(19-27(29)23-15-11-8-12-16-23)18-26-17-24(22-13-9-7-10-14-22)20-30(31(26)28)33(4,5)6/h7-17,19-21H,18H2,1-6H3 |
| InChIKey | LPOKMOAXSYZLKH-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |