C41H50 — CID 87195698
3,5-ditert-butyl-2,7-bis(4-tert-butylphenyl)-9H-fluorene (PubChem CID 87195698) has the molecular formula C41H50 and a molecular weight of 542.85 g/mol. Its IUPAC name is 3,5-ditert-butyl-2,7-bis(4-tert-butylphenyl)-9H-fluorene.
| Compound Name | 3,5-ditert-butyl-2,7-bis(4-tert-butylphenyl)-9H-fluorene |
|---|---|
| PubChem CID | 87195698 |
| Molecular Formula | C41H50 |
| Molecular Weight | 542.85 g/mol |
| Exact Mass | 542.39 |
| IUPAC Name | 3,5-ditert-butyl-2,7-bis(4-tert-butylphenyl)-9H-fluorene |
| SMILES | CC(C)(C)c1ccc(-c2cc3c(c(C(C)(C)C)c2)-c2cc(C(C)(C)C)c(-c4ccc(C(C)(C)C)cc4)cc2C3)cc1 |
| InChI | InChI=1S/C41H50/c1-38(2,3)31-17-13-26(14-18-31)28-21-30-22-29-23-33(27-15-19-32(20-16-27)39(4,5)6)35(40(7,8)9)25-34(29)37(30)36(24-28)41(10,11)12/h13-21,23-25H,22H2,1-12H3 |
| InChIKey | GAOHSBIYKBVNKD-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.85 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |