C81H98O2 — CID 158084210
2,7-bis[3,5-bis(4-tert-butylphenyl)phenyl]-3,6-dioctoxy-9H-fluorene (PubChem CID 158084210) has the molecular formula C81H98O2 and a molecular weight of 1103.67 g/mol. Its IUPAC name is 2,7-bis[3,5-bis(4-tert-butylphenyl)phenyl]-3,6-dioctoxy-9H-fluorene.
| Compound Name | 2,7-bis[3,5-bis(4-tert-butylphenyl)phenyl]-3,6-dioctoxy-9H-fluorene |
|---|---|
| PubChem CID | 158084210 |
| Molecular Formula | C81H98O2 |
| Molecular Weight | 1103.67 g/mol |
| Exact Mass | 1102.76 |
| IUPAC Name | 2,7-bis[3,5-bis(4-tert-butylphenyl)phenyl]-3,6-dioctoxy-9H-fluorene |
| SMILES | CCCCCCCCOc1cc2c(cc1-c1cc(-c3ccc(C(C)(C)C)cc3)cc(-c3ccc(C(C)(C)C)cc3)c1)Cc1cc(-c3cc(-c4ccc(C(C)(C)C)cc4)cc(-c4ccc(C(C)(C)C)cc4)c3)c(OCCCCCCCC)cc1-2 |
| InChI | InChI=1S/C81H98O2/c1-15-17-19-21-23-25-43-82-76-54-72-66(52-74(76)64-47-60(56-27-35-68(36-28-56)78(3,4)5)45-61(48-64)57-29-37-69(38-30-57)79(6,7)8)51-67-53-75(77(55-73(67)72)83-44-26-24-22-20-18-16-2)65-49-62(58-31-39-70(40-32-58)80(9,10)11)46-63(50-65)59-33-41-71(42-34-59)81(12,13)14/h27-42,45-50,52-55H,15-26,43-44,51H2,1-14H3 |
| InChIKey | ICRRJFZYPCUGCL-UHFFFAOYSA-N |
| XLogP | 23.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1103.67 |
| LogP ≤ 5 | 23.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|