C23H34N2O4 — CID 144806892
ethane;1-[6-methoxy-5-[2-(2-oxa-8-azaspiro[4.5]decan-8-yl)ethoxy]-1H-indol-2-yl]ethanone (PubChem CID 144806892) has the molecular formula C23H34N2O4 and a molecular weight of 402.54 g/mol. Its IUPAC name is ethane;1-[6-methoxy-5-[2-(2-oxa-8-azaspiro[4.5]decan-8-yl)ethoxy]-1H-indol-2-yl]ethanone.
| Compound Name | ethane;1-[6-methoxy-5-[2-(2-oxa-8-azaspiro[4.5]decan-8-yl)ethoxy]-1H-indol-2-yl]ethanone |
|---|---|
| PubChem CID | 144806892 |
| Molecular Formula | C23H34N2O4 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | ethane;1-[6-methoxy-5-[2-(2-oxa-8-azaspiro[4.5]decan-8-yl)ethoxy]-1H-indol-2-yl]ethanone |
| SMILES | CC.COc1cc2[nH]c(C(C)=O)cc2cc1OCCN1CCC2(CCOC2)CC1 |
| InChI | InChI=1S/C21H28N2O4.C2H6/c1-15(24)17-11-16-12-20(19(25-2)13-18(16)22-17)27-10-8-23-6-3-21(4-7-23)5-9-26-14-21;1-2/h11-13,22H,3-10,14H2,1-2H3;1-2H3 |
| InChIKey | RVJROOXWUXIURR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |