C26H31N5O6 — CID 144807686
3-[[4-[3-(2,4-dihydroxy-5-propan-2-ylphenyl)-5-(ethylcarbamoyl)-1,2,4-triazol-4-yl]benzoyl]-methylamino]propyl formate (PubChem CID 144807686) has the molecular formula C26H31N5O6 and a molecular weight of 509.56 g/mol. Its IUPAC name is 3-[[4-[3-(2,4-dihydroxy-5-propan-2-ylphenyl)-5-(ethylcarbamoyl)-1,2,4-triazol-4-yl]benzoyl]-methylamino]propyl formate.
| Compound Name | 3-[[4-[3-(2,4-dihydroxy-5-propan-2-ylphenyl)-5-(ethylcarbamoyl)-1,2,4-triazol-4-yl]benzoyl]-methylamino]propyl formate |
|---|---|
| PubChem CID | 144807686 |
| Molecular Formula | C26H31N5O6 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | 3-[[4-[3-(2,4-dihydroxy-5-propan-2-ylphenyl)-5-(ethylcarbamoyl)-1,2,4-triazol-4-yl]benzoyl]-methylamino]propyl formate |
| SMILES | CCNC(=O)c1nnc(-c2cc(C(C)C)c(O)cc2O)n1-c1ccc(C(=O)N(C)CCCOC=O)cc1 |
| InChI | InChI=1S/C26H31N5O6/c1-5-27-25(35)24-29-28-23(20-13-19(16(2)3)21(33)14-22(20)34)31(24)18-9-7-17(8-10-18)26(36)30(4)11-6-12-37-15-32/h7-10,13-16,33-34H,5-6,11-12H2,1-4H3,(H,27,35) |
| InChIKey | NGCXSFUDOWWQIO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 146.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|