C34H39N5O7 — CID 137053083
4-[4-[[4-[(3,6-dihydroxy-2-methyloxan-4-yl)carbamoyl]phenyl]methyl]phenyl]-5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-ethyl-1,2,4-triazole-3-carboxamide (PubChem CID 137053083) has the molecular formula C34H39N5O7 and a molecular weight of 629.71 g/mol. Its IUPAC name is 4-[4-[[4-[(3,6-dihydroxy-2-methyloxan-4-yl)carbamoyl]phenyl]methyl]phenyl]-5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-ethyl-1,2,4-triazole-3-carboxamide.
| Compound Name | 4-[4-[[4-[(3,6-dihydroxy-2-methyloxan-4-yl)carbamoyl]phenyl]methyl]phenyl]-5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-ethyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 137053083 |
| Molecular Formula | C34H39N5O7 |
| Molecular Weight | 629.71 g/mol |
| Exact Mass | 629.28 |
| IUPAC Name | 4-[4-[[4-[(3,6-dihydroxy-2-methyloxan-4-yl)carbamoyl]phenyl]methyl]phenyl]-5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-ethyl-1,2,4-triazole-3-carboxamide |
| SMILES | CCNC(=O)c1nnc(-c2cc(C(C)C)c(O)cc2O)n1-c1ccc(Cc2ccc(C(=O)NC3CC(O)OC(C)C3O)cc2)cc1 |
| InChI | InChI=1S/C34H39N5O7/c1-5-35-34(45)32-38-37-31(25-15-24(18(2)3)27(40)17-28(25)41)39(32)23-12-8-21(9-13-23)14-20-6-10-22(11-7-20)33(44)36-26-16-29(42)46-19(4)30(26)43/h6-13,15,17-19,26,29-30,40-43H,5,14,16H2,1-4H3,(H,35,45)(H,36,44) |
| InChIKey | LUCPWUKALUEFFT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 179.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.71 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |