C17H25FO2 — CID 144809384
1-[3-fluoro-4-(2-methylpropoxy)cyclohexyl]-4-methoxybenzene (PubChem CID 144809384) has the molecular formula C17H25FO2 and a molecular weight of 280.38 g/mol. Its IUPAC name is 1-[3-fluoro-4-(2-methylpropoxy)cyclohexyl]-4-methoxybenzene.
| Compound Name | 1-[3-fluoro-4-(2-methylpropoxy)cyclohexyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 144809384 |
| Molecular Formula | C17H25FO2 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 1-[3-fluoro-4-(2-methylpropoxy)cyclohexyl]-4-methoxybenzene |
| SMILES | COc1ccc(C2CCC(OCC(C)C)C(F)C2)cc1 |
| InChI | InChI=1S/C17H25FO2/c1-12(2)11-20-17-9-6-14(10-16(17)18)13-4-7-15(19-3)8-5-13/h4-5,7-8,12,14,16-17H,6,9-11H2,1-3H3 |
| InChIKey | XPRIUOAJEROYMW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |