C31H47F7O4 — CID 144809437
5-[4-[4-(1,1,2,3,3,3-hexafluoropropoxy)cyclohexyl]cyclohexyl]hexan-2-yl (E)-3-(2-fluoro-4-methoxycyclohexyl)prop-2-enoate (PubChem CID 144809437) has the molecular formula C31H47F7O4 and a molecular weight of 616.70 g/mol. Its IUPAC name is 5-[4-[4-(1,1,2,3,3,3-hexafluoropropoxy)cyclohexyl]cyclohexyl]hexan-2-yl (E)-3-(2-fluoro-4-methoxycyclohexyl)prop-2-enoate.
| Compound Name | 5-[4-[4-(1,1,2,3,3,3-hexafluoropropoxy)cyclohexyl]cyclohexyl]hexan-2-yl (E)-3-(2-fluoro-4-methoxycyclohexyl)prop-2-enoate |
|---|---|
| PubChem CID | 144809437 |
| Molecular Formula | C31H47F7O4 |
| Molecular Weight | 616.70 g/mol |
| Exact Mass | 616.34 |
| IUPAC Name | 5-[4-[4-(1,1,2,3,3,3-hexafluoropropoxy)cyclohexyl]cyclohexyl]hexan-2-yl (E)-3-(2-fluoro-4-methoxycyclohexyl)prop-2-enoate |
| SMILES | COC1CCC(/C=C/C(=O)OC(C)CCC(C)C2CCC(C3CCC(OC(F)(F)C(F)C(F)(F)F)CC3)CC2)C(F)C1 |
| InChI | InChI=1S/C31H47F7O4/c1-19(4-5-20(2)41-28(39)17-13-24-12-16-26(40-3)18-27(24)32)21-6-8-22(9-7-21)23-10-14-25(15-11-23)42-31(37,38)29(33)30(34,35)36/h13,17,19-27,29H,4-12,14-16,18H2,1-3H3/b17-13+ |
| InChIKey | RYVAENXRUQFJGD-GHRIWEEISA-N |
| XLogP | 8.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.70 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|