C25H40F4O — CID 144809460
1-propyl-4-[4-[(3,3,4,4-tetrafluoro-5-methylideneoct-1-en-2-yl)oxymethyl]cyclohexyl]cyclohexane (PubChem CID 144809460) has the molecular formula C25H40F4O and a molecular weight of 432.59 g/mol. Its IUPAC name is 1-propyl-4-[4-[(3,3,4,4-tetrafluoro-5-methylideneoct-1-en-2-yl)oxymethyl]cyclohexyl]cyclohexane.
| Compound Name | 1-propyl-4-[4-[(3,3,4,4-tetrafluoro-5-methylideneoct-1-en-2-yl)oxymethyl]cyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 144809460 |
| Molecular Formula | C25H40F4O |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | 1-propyl-4-[4-[(3,3,4,4-tetrafluoro-5-methylideneoct-1-en-2-yl)oxymethyl]cyclohexyl]cyclohexane |
| SMILES | C=C(CCC)C(F)(F)C(F)(F)C(=C)OCC1CCC(C2CCC(CCC)CC2)CC1 |
| InChI | InChI=1S/C25H40F4O/c1-5-7-18(3)24(26,27)25(28,29)19(4)30-17-21-11-15-23(16-12-21)22-13-9-20(8-6-2)10-14-22/h20-23H,3-17H2,1-2H3 |
| InChIKey | GMYIKTCVAZYLST-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|